About [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol
[1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol (PubChem CID 75384495) has the molecular formula C18H26N4OS
and a molecular weight of 346.50 g/mol. Its IUPAC name is [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol |
| PubChem CID | 75384495 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol |
| SMILES | CC(C)c1nc(CNc2ccc(N3CCC(CO)CC3)cn2)cs1 |
| InChI | InChI=1S/C18H26N4OS/c1-13(2)18-21-15(12-24-18)9-19-17-4-3-16(10-20-17)22-7-5-14(11-23)6-8-22/h3-4,10,12-14,23H,5-9,11H2,1-2H3,(H,19,20) |
| InChIKey | FCODJDMNKKSMLT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol?
The IUPAC name of [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol (CID 75384495) is [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol is CC(C)c1nc(CNc2ccc(N3CCC(CO)CC3)cn2)cs1.
What is the InChIKey of [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol?
The InChIKey is FCODJDMNKKSMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4OS/c1-13(2)18-21-15(12-24-18)9-19-17-4-3-16(10-20-17)22-7-5-14(11-23)6-8-22/h3-4,10,12-14,23H,5-9,11H2,1-2H3,(H,19,20).
What are the key properties of [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol?
[1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol has a molecular weight of 346.50 g/mol, XLogP of 3.48, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[6-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]-3-pyridinyl]piperidin-4-yl]methanol is sourced from PubChem (CID 75384495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).