About 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide
3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide (PubChem CID 75385359) has the molecular formula C17H23N3OS2
and a molecular weight of 349.53 g/mol. Its IUPAC name is 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide.
Molecular Properties
| Compound Name | 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide |
| PubChem CID | 75385359 |
| Molecular Formula | C17H23N3OS2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide |
| SMILES | CC(C)(C)c1ncc(CNc2ccccc2SCCC(N)=O)s1 |
| InChI | InChI=1S/C17H23N3OS2/c1-17(2,3)16-20-11-12(23-16)10-19-13-6-4-5-7-14(13)22-9-8-15(18)21/h4-7,11,19H,8-10H2,1-3H3,(H2,18,21) |
| InChIKey | MVDQSJBXOIJVMZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide?
The IUPAC name of 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide (CID 75385359) is 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide.
What is the SMILES notation for 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide?
The canonical SMILES for 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide is CC(C)(C)c1ncc(CNc2ccccc2SCCC(N)=O)s1.
What is the InChIKey of 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide?
The InChIKey is MVDQSJBXOIJVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3OS2/c1-17(2,3)16-20-11-12(23-16)10-19-13-6-4-5-7-14(13)22-9-8-15(18)21/h4-7,11,19H,8-10H2,1-3H3,(H2,18,21).
What are the key properties of 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide?
3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide has a molecular weight of 349.53 g/mol, XLogP of 4.02, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2-tert-butyl-1,3-thiazol-5-yl)methylamino]phenyl]sulfanylpropanamide is sourced from PubChem (CID 75385359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).