About N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline
N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline (PubChem CID 75386379) has the molecular formula C13H12N4S
and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline.
Molecular Properties
| Compound Name | N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline |
| PubChem CID | 75386379 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline |
| SMILES | c1cc(NCc2ccsc2)cc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C13H12N4S/c1-2-11(13-15-9-16-17-13)6-12(3-1)14-7-10-4-5-18-8-10/h1-6,8-9,14H,7H2,(H,15,16,17) |
| InChIKey | SIWDERXWLOUBBY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline?
The IUPAC name of N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline (CID 75386379) is N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline.
What is the SMILES notation for N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline?
The canonical SMILES for N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline is c1cc(NCc2ccsc2)cc(-c2ncn[nH]2)c1.
What is the InChIKey of N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline?
The InChIKey is SIWDERXWLOUBBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S/c1-2-11(13-15-9-16-17-13)6-12(3-1)14-7-10-4-5-18-8-10/h1-6,8-9,14H,7H2,(H,15,16,17).
What are the key properties of N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline?
N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline has a molecular weight of 256.33 g/mol, XLogP of 3.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thiophen-3-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)aniline is sourced from PubChem (CID 75386379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).