About N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide
N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide (PubChem CID 75386462) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide.
Molecular Properties
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide |
| PubChem CID | 75386462 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)C2CN(C)CCO2)c1 |
| InChI | InChI=1S/C13H19N3O2/c1-9-6-10(2)14-12(7-9)15-13(17)11-8-16(3)4-5-18-11/h6-7,11H,4-5,8H2,1-3H3,(H,14,15,17) |
| InChIKey | BADSGLKHIMBPNP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide?
The IUPAC name of N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide (CID 75386462) is N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide.
What is the SMILES notation for N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide?
The canonical SMILES for N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide is Cc1cc(C)nc(NC(=O)C2CN(C)CCO2)c1.
What is the InChIKey of N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide?
The InChIKey is BADSGLKHIMBPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-9-6-10(2)14-12(7-9)15-13(17)11-8-16(3)4-5-18-11/h6-7,11H,4-5,8H2,1-3H3,(H,14,15,17).
What are the key properties of N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide?
N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide has a molecular weight of 249.31 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethyl-2-pyridinyl)-4-methylmorpholine-2-carboxamide is sourced from PubChem (CID 75386462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).