C15H15F3N10O — CID 75386925
N-[2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 75386925) has the molecular formula C15H15F3N10O and a molecular weight of 408.35 g/mol. Its IUPAC name is N-[2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 75386925 |
| Molecular Formula | C15H15F3N10O |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CC(C)(C)C(Nc1ccc2nnc(C(F)(F)F)n2n1)c1nc(-c2ncn[nH]2)no1 |
| InChI | InChI=1S/C15H15F3N10O/c1-14(2,3)9(12-22-11(27-29-12)10-19-6-20-24-10)21-7-4-5-8-23-25-13(15(16,17)18)28(8)26-7/h4-6,9H,1-3H3,(H,21,26)(H,19,20,24) |
| InChIKey | GXQPKILJBRBKOQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |