About 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide
2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide (PubChem CID 75387225) has the molecular formula C14H12FN3O2S2
and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide |
| PubChem CID | 75387225 |
| Molecular Formula | C14H12FN3O2S2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide |
| SMILES | N#Cc1c(F)cccc1S(=O)(=O)NC(c1nccs1)C1CC1 |
| InChI | InChI=1S/C14H12FN3O2S2/c15-11-2-1-3-12(10(11)8-16)22(19,20)18-13(9-4-5-9)14-17-6-7-21-14/h1-3,6-7,9,13,18H,4-5H2 |
| InChIKey | UUQCBQAKVHWTSD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide?
The IUPAC name of 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide (CID 75387225) is 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide.
What is the SMILES notation for 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide?
The canonical SMILES for 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide is N#Cc1c(F)cccc1S(=O)(=O)NC(c1nccs1)C1CC1.
What is the InChIKey of 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide?
The InChIKey is UUQCBQAKVHWTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O2S2/c15-11-2-1-3-12(10(11)8-16)22(19,20)18-13(9-4-5-9)14-17-6-7-21-14/h1-3,6-7,9,13,18H,4-5H2.
What are the key properties of 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide?
2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide has a molecular weight of 337.40 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-fluorobenzenesulfonamide is sourced from PubChem (CID 75387225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).