About N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine
N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine (PubChem CID 75387539) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine |
| PubChem CID | 75387539 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine |
| SMILES | CCC(CC)CNCCc1cnn(C)c1C |
| InChI | InChI=1S/C13H25N3/c1-5-12(6-2)9-14-8-7-13-10-15-16(4)11(13)3/h10,12,14H,5-9H2,1-4H3 |
| InChIKey | SELDLUXAVRAILM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine?
The IUPAC name of N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine (CID 75387539) is N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine.
What is the SMILES notation for N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine?
The canonical SMILES for N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine is CCC(CC)CNCCc1cnn(C)c1C.
What is the InChIKey of N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine?
The InChIKey is SELDLUXAVRAILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-5-12(6-2)9-14-8-7-13-10-15-16(4)11(13)3/h10,12,14H,5-9H2,1-4H3.
What are the key properties of N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine?
N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine has a molecular weight of 223.36 g/mol, XLogP of 2.30, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,5-dimethylpyrazol-4-yl)ethyl]-2-ethylbutan-1-amine is sourced from PubChem (CID 75387539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).