C17H20ClNO4 — CID 75387563
(5-chlorofuran-2-yl)-[2-[2-(furan-2-yl)-2-hydroxyethyl]azepan-1-yl]methanone (PubChem CID 75387563) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-[2-[2-(furan-2-yl)-2-hydroxyethyl]azepan-1-yl]methanone.
| Compound Name | (5-chlorofuran-2-yl)-[2-[2-(furan-2-yl)-2-hydroxyethyl]azepan-1-yl]methanone |
|---|---|
| PubChem CID | 75387563 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (5-chlorofuran-2-yl)-[2-[2-(furan-2-yl)-2-hydroxyethyl]azepan-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)o1)N1CCCCCC1CC(O)c1ccco1 |
| InChI | InChI=1S/C17H20ClNO4/c18-16-8-7-15(23-16)17(21)19-9-3-1-2-5-12(19)11-13(20)14-6-4-10-22-14/h4,6-8,10,12-13,20H,1-3,5,9,11H2 |
| InChIKey | PGQSRWLOXXITKX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |