About 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide
3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide (PubChem CID 75387634) has the molecular formula C11H19F3N2O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide |
| PubChem CID | 75387634 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide |
| SMILES | CC1COCCN1C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2/c1-9-8-18-7-6-16(9)10(17)15-5-3-2-4-11(12,13)14/h9H,2-8H2,1H3,(H,15,17) |
| InChIKey | ATDYJDMJTVMIDO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide?
The IUPAC name of 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide (CID 75387634) is 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide.
What is the SMILES notation for 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide?
The canonical SMILES for 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide is CC1COCCN1C(=O)NCCCCC(F)(F)F.
What is the InChIKey of 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide?
The InChIKey is ATDYJDMJTVMIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2/c1-9-8-18-7-6-16(9)10(17)15-5-3-2-4-11(12,13)14/h9H,2-8H2,1H3,(H,15,17).
What are the key properties of 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide?
3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide has a molecular weight of 268.28 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(5,5,5-trifluoropentyl)morpholine-4-carboxamide is sourced from PubChem (CID 75387634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).