C22H20N6O3 — CID 75387960
(E)-N'-(1H-indazol-5-yl)-N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]but-2-enediamide (PubChem CID 75387960) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is (E)-N'-(1H-indazol-5-yl)-N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]but-2-enediamide.
| Compound Name | (E)-N'-(1H-indazol-5-yl)-N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]but-2-enediamide |
|---|---|
| PubChem CID | 75387960 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (E)-N'-(1H-indazol-5-yl)-N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]but-2-enediamide |
| SMILES | COc1ccc(-n2ccc(CNC(=O)/C=C/C(=O)Nc3ccc4[nH]ncc4c3)n2)cc1 |
| InChI | InChI=1S/C22H20N6O3/c1-31-19-5-3-18(4-6-19)28-11-10-17(27-28)14-23-21(29)8-9-22(30)25-16-2-7-20-15(12-16)13-24-26-20/h2-13H,14H2,1H3,(H,23,29)(H,24,26)(H,25,30)/b9-8+ |
| InChIKey | YGJICTMWMXHRSC-CMDGGOBGSA-N |
| XLogP | 2.57 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|