About 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea (PubChem CID 75388410) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea |
| PubChem CID | 75388410 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)NCCC1=CCOCC1)C1CCCO1 |
| InChI | InChI=1S/C14H24N2O3/c1-11(13-3-2-8-19-13)16-14(17)15-7-4-12-5-9-18-10-6-12/h5,11,13H,2-4,6-10H2,1H3,(H2,15,16,17) |
| InChIKey | RPLDGBPHXWEMQD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea?
The IUPAC name of 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea (CID 75388410) is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea.
What is the SMILES notation for 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea?
The canonical SMILES for 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea is CC(NC(=O)NCCC1=CCOCC1)C1CCCO1.
What is the InChIKey of 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea?
The InChIKey is RPLDGBPHXWEMQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-11(13-3-2-8-19-13)16-14(17)15-7-4-12-5-9-18-10-6-12/h5,11,13H,2-4,6-10H2,1H3,(H2,15,16,17).
What are the key properties of 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea?
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea has a molecular weight of 268.36 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-[1-(oxolan-2-yl)ethyl]urea is sourced from PubChem (CID 75388410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).