About 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide
4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 753886) has the molecular formula C16H12N2O3S2
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 753886 |
| Molecular Formula | C16H12N2O3S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12N2O3S2/c19-15(18-16-17-10-11-22-16)12-6-8-14(9-7-12)23(20,21)13-4-2-1-3-5-13/h1-11H,(H,17,18,19) |
| InChIKey | OYPLNKZVSKRHMR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide (CID 753886) is 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide is O=C(Nc1nccs1)c1ccc(S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is OYPLNKZVSKRHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O3S2/c19-15(18-16-17-10-11-22-16)12-6-8-14(9-7-12)23(20,21)13-4-2-1-3-5-13/h1-11H,(H,17,18,19).
What are the key properties of 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide?
4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 344.42 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 753886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).