About N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide
N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 75388847) has the molecular formula C15H20N2O3S2
and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 75388847 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | COc1ccc(CC(C)N(C)S(=O)(=O)c2cnc(C)s2)cc1 |
| InChI | InChI=1S/C15H20N2O3S2/c1-11(9-13-5-7-14(20-4)8-6-13)17(3)22(18,19)15-10-16-12(2)21-15/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | YBERCBFFPBVHRZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide (CID 75388847) is N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide is COc1ccc(CC(C)N(C)S(=O)(=O)c2cnc(C)s2)cc1.
What is the InChIKey of N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is YBERCBFFPBVHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S2/c1-11(9-13-5-7-14(20-4)8-6-13)17(3)22(18,19)15-10-16-12(2)21-15/h5-8,10-11H,9H2,1-4H3.
What are the key properties of N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 340.47 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-methoxyphenyl)propan-2-yl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 75388847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).