C17H27N7O — CID 75389088
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 75389088) has the molecular formula C17H27N7O and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 75389088 |
| Molecular Formula | C17H27N7O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | CCc1nn(C)c(CC)c1CNC(=O)NC1CCc2nc(C)nn2C1 |
| InChI | InChI=1S/C17H27N7O/c1-5-14-13(15(6-2)23(4)22-14)9-18-17(25)20-12-7-8-16-19-11(3)21-24(16)10-12/h12H,5-10H2,1-4H3,(H2,18,20,25) |
| InChIKey | LIQDQFTUXIVAPJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |