About (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate
(3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate (PubChem CID 75389219) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate |
| PubChem CID | 75389219 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate |
| SMILES | CC(=O)c1cccc(COC(=O)c2cc(C(C)C)nn2C)c1 |
| InChI | InChI=1S/C17H20N2O3/c1-11(2)15-9-16(19(4)18-15)17(21)22-10-13-6-5-7-14(8-13)12(3)20/h5-9,11H,10H2,1-4H3 |
| InChIKey | DBYPFVQEHKKGFL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate?
The IUPAC name of (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate (CID 75389219) is (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate.
What is the SMILES notation for (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate?
The canonical SMILES for (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate is CC(=O)c1cccc(COC(=O)c2cc(C(C)C)nn2C)c1.
What is the InChIKey of (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate?
The InChIKey is DBYPFVQEHKKGFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-11(2)15-9-16(19(4)18-15)17(21)22-10-13-6-5-7-14(8-13)12(3)20/h5-9,11H,10H2,1-4H3.
What are the key properties of (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate?
(3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate has a molecular weight of 300.36 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylphenyl)methyl 1-methyl-3-propan-2-ylpyrazole-5-carboxylate is sourced from PubChem (CID 75389219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).