C15H25N3O3S — CID 75389859
(4aR,8aR)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 75389859) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is (4aR,8aR)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aR)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 75389859 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (4aR,8aR)-1-[1-(2-methoxyethyl)pyrazol-4-yl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | COCCn1cc(S(=O)(=O)N2CCC[C@H]3CCCC[C@H]32)cn1 |
| InChI | InChI=1S/C15H25N3O3S/c1-21-10-9-17-12-14(11-16-17)22(19,20)18-8-4-6-13-5-2-3-7-15(13)18/h11-13,15H,2-10H2,1H3/t13-,15-/m1/s1 |
| InChIKey | LKSCAOYUGUSORU-UKRRQHHQSA-N |
| XLogP | 1.87 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |