About N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide
N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide (PubChem CID 75389998) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide |
| PubChem CID | 75389998 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide |
| SMILES | CC(C)Oc1cccc(CN(C)C(=O)Cc2ccon2)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-12(2)21-15-6-4-5-13(9-15)11-18(3)16(19)10-14-7-8-20-17-14/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | BRMBKJNLZKRPED-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide?
The IUPAC name of N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide (CID 75389998) is N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide.
What is the SMILES notation for N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide?
The canonical SMILES for N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide is CC(C)Oc1cccc(CN(C)C(=O)Cc2ccon2)c1.
What is the InChIKey of N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide?
The InChIKey is BRMBKJNLZKRPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-12(2)21-15-6-4-5-13(9-15)11-18(3)16(19)10-14-7-8-20-17-14/h4-9,12H,10-11H2,1-3H3.
What are the key properties of N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide?
N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide has a molecular weight of 288.35 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(1,2-oxazol-3-yl)-N-[(3-propan-2-yloxyphenyl)methyl]acetamide is sourced from PubChem (CID 75389998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).