C19H28N4O2 — CID 75390001
1-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-[1-(oxolan-2-yl)propyl]urea (PubChem CID 75390001) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-[1-(oxolan-2-yl)propyl]urea.
| Compound Name | 1-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-[1-(oxolan-2-yl)propyl]urea |
|---|---|
| PubChem CID | 75390001 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[2-(1-ethylbenzimidazol-2-yl)ethyl]-3-[1-(oxolan-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)NCCc1nc2ccccc2n1CC)C1CCCO1 |
| InChI | InChI=1S/C19H28N4O2/c1-3-14(17-10-7-13-25-17)22-19(24)20-12-11-18-21-15-8-5-6-9-16(15)23(18)4-2/h5-6,8-9,14,17H,3-4,7,10-13H2,1-2H3,(H2,20,22,24) |
| InChIKey | WMWVYHNYNYRHDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |