C19H26N2O3 — CID 75390049
tert-butyl (2S,3S)-2-[[3-(cyanomethyl)benzoyl]amino]-3-methylpentanoate (PubChem CID 75390049) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[[3-(cyanomethyl)benzoyl]amino]-3-methylpentanoate.
| Compound Name | tert-butyl (2S,3S)-2-[[3-(cyanomethyl)benzoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 75390049 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl (2S,3S)-2-[[3-(cyanomethyl)benzoyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cccc(CC#N)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N2O3/c1-6-13(2)16(18(23)24-19(3,4)5)21-17(22)15-9-7-8-14(12-15)10-11-20/h7-9,12-13,16H,6,10H2,1-5H3,(H,21,22)/t13-,16-/m0/s1 |
| InChIKey | PTLOJYVMLHFEQY-BBRMVZONSA-N |
| XLogP | 3.24 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |