About 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide
4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide (PubChem CID 75390214) has the molecular formula C19H24N2O3
and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide |
| PubChem CID | 75390214 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide |
| SMILES | CC1(C2CCN(C(=O)NCC#Cc3ccccc3)CC2)OCCO1 |
| InChI | InChI=1S/C19H24N2O3/c1-19(23-14-15-24-19)17-9-12-21(13-10-17)18(22)20-11-5-8-16-6-3-2-4-7-16/h2-4,6-7,17H,9-15H2,1H3,(H,20,22) |
| InChIKey | FVRCPIRPNDRNNE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide?
The IUPAC name of 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide (CID 75390214) is 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide.
What is the SMILES notation for 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide?
The canonical SMILES for 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide is CC1(C2CCN(C(=O)NCC#Cc3ccccc3)CC2)OCCO1.
What is the InChIKey of 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide?
The InChIKey is FVRCPIRPNDRNNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3/c1-19(23-14-15-24-19)17-9-12-21(13-10-17)18(22)20-11-5-8-16-6-3-2-4-7-16/h2-4,6-7,17H,9-15H2,1H3,(H,20,22).
What are the key properties of 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide?
4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide has a molecular weight of 328.41 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-dioxolan-2-yl)-N-(3-phenylprop-2-ynyl)piperidine-1-carboxamide is sourced from PubChem (CID 75390214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).