C17H24N4O — CID 75390778
N,N-dimethyl-4-[(1-propan-2-ylimidazol-2-yl)methyl]-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 75390778) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1-propan-2-ylimidazol-2-yl)methyl]-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | N,N-dimethyl-4-[(1-propan-2-ylimidazol-2-yl)methyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 75390778 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N,N-dimethyl-4-[(1-propan-2-ylimidazol-2-yl)methyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | CC(C)n1ccnc1CN1CCOc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C17H24N4O/c1-13(2)21-8-7-18-17(21)12-20-9-10-22-16-11-14(19(3)4)5-6-15(16)20/h5-8,11,13H,9-10,12H2,1-4H3 |
| InChIKey | XJXGYCYWESTFIE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|