C10H8N2O4 — CID 753908
spiro[1,3-benzodioxole-2,4'-diazinane]-3',6'-dione (PubChem CID 753908) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is spiro[1,3-benzodioxole-2,4'-diazinane]-3',6'-dione.
| Compound Name | spiro[1,3-benzodioxole-2,4'-diazinane]-3',6'-dione |
|---|---|
| PubChem CID | 753908 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | spiro[1,3-benzodioxole-2,4'-diazinane]-3',6'-dione |
| SMILES | O=C1CC2(Oc3ccccc3O2)C(=O)NN1 |
| InChI | InChI=1S/C10H8N2O4/c13-8-5-10(9(14)12-11-8)15-6-3-1-2-4-7(6)16-10/h1-4H,5H2,(H,11,13)(H,12,14) |
| InChIKey | VASUTEHXLHJYKU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |