About 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide
2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 75391003) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| PubChem CID | 75391003 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)Cn1ncn(C)c1=O)c1cccs1 |
| InChI | InChI=1S/C11H14N4O2S/c1-8(9-4-3-5-18-9)13-10(16)6-15-11(17)14(2)7-12-15/h3-5,7-8H,6H2,1-2H3,(H,13,16) |
| InChIKey | PVMYIVPFSOJEFU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide?
The IUPAC name of 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide (CID 75391003) is 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide.
What is the SMILES notation for 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide?
The canonical SMILES for 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide is CC(NC(=O)Cn1ncn(C)c1=O)c1cccs1.
What is the InChIKey of 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide?
The InChIKey is PVMYIVPFSOJEFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c1-8(9-4-3-5-18-9)13-10(16)6-15-11(17)14(2)7-12-15/h3-5,7-8H,6H2,1-2H3,(H,13,16).
What are the key properties of 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide?
2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide has a molecular weight of 266.33 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-5-oxo-1,2,4-triazol-1-yl)-N-(1-thiophen-2-ylethyl)acetamide is sourced from PubChem (CID 75391003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).