C13H14F3N5O2 — CID 75391338
ethyl 2-[prop-2-enyl-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]acetate (PubChem CID 75391338) has the molecular formula C13H14F3N5O2 and a molecular weight of 329.28 g/mol. Its IUPAC name is ethyl 2-[prop-2-enyl-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]acetate.
| Compound Name | ethyl 2-[prop-2-enyl-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]acetate |
|---|---|
| PubChem CID | 75391338 |
| Molecular Formula | C13H14F3N5O2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | ethyl 2-[prop-2-enyl-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]acetate |
| SMILES | C=CCN(CC(=O)OCC)c1cc(C(F)(F)F)nc2ncnn12 |
| InChI | InChI=1S/C13H14F3N5O2/c1-3-5-20(7-11(22)23-4-2)10-6-9(13(14,15)16)19-12-17-8-18-21(10)12/h3,6,8H,1,4-5,7H2,2H3 |
| InChIKey | XOKVFYYSFMSLSI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|