About 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione
6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 75391776) has the molecular formula C14H21N5O5
and a molecular weight of 339.35 g/mol. Its IUPAC name is 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 75391776 |
| Molecular Formula | C14H21N5O5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(C(=O)CN2CCN(C(=O)CO)CC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H21N5O5/c1-16-12(15)11(13(23)17(2)14(16)24)9(21)7-18-3-5-19(6-4-18)10(22)8-20/h20H,3-8,15H2,1-2H3 |
| InChIKey | IXDMOAGAZTZLRJ-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione (CID 75391776) is 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione is Cn1c(N)c(C(=O)CN2CCN(C(=O)CO)CC2)c(=O)n(C)c1=O.
What is the InChIKey of 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is IXDMOAGAZTZLRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O5/c1-16-12(15)11(13(23)17(2)14(16)24)9(21)7-18-3-5-19(6-4-18)10(22)8-20/h20H,3-8,15H2,1-2H3.
What are the key properties of 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione?
6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 339.35 g/mol, XLogP of -3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[2-[4-(2-hydroxyacetyl)piperazin-1-yl]acetyl]-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 75391776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).