About 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile
4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile (PubChem CID 75392179) has the molecular formula C8H12N2S2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile.
Molecular Properties
| Compound Name | 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile |
| PubChem CID | 75392179 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile |
| SMILES | CC1CSC(SCCCC#N)=N1 |
| InChI | InChI=1S/C8H12N2S2/c1-7-6-12-8(10-7)11-5-3-2-4-9/h7H,2-3,5-6H2,1H3 |
| InChIKey | NZRCOHNZTASDEN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile?
The IUPAC name of 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile (CID 75392179) is 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile.
What is the SMILES notation for 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile?
The canonical SMILES for 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile is CC1CSC(SCCCC#N)=N1.
What is the InChIKey of 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile?
The InChIKey is NZRCOHNZTASDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-7-6-12-8(10-7)11-5-3-2-4-9/h7H,2-3,5-6H2,1H3.
What are the key properties of 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile?
4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile has a molecular weight of 200.33 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]butanenitrile is sourced from PubChem (CID 75392179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).