C13H13N3O7S2 — CID 75392215
N-(4-hydroxy-3-sulfamoylphenyl)-2-methyl-6-nitrobenzenesulfonamide (PubChem CID 75392215) has the molecular formula C13H13N3O7S2 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-(4-hydroxy-3-sulfamoylphenyl)-2-methyl-6-nitrobenzenesulfonamide.
| Compound Name | N-(4-hydroxy-3-sulfamoylphenyl)-2-methyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 75392215 |
| Molecular Formula | C13H13N3O7S2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-(4-hydroxy-3-sulfamoylphenyl)-2-methyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)Nc1ccc(O)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H13N3O7S2/c1-8-3-2-4-10(16(18)19)13(8)25(22,23)15-9-5-6-11(17)12(7-9)24(14,20)21/h2-7,15,17H,1H3,(H2,14,20,21) |
| InChIKey | ZHYPSUCKPHQTRF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 169.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|