About N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide
N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide (PubChem CID 75392450) has the molecular formula C12H13ClN2O3S2
and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide |
| PubChem CID | 75392450 |
| Molecular Formula | C12H13ClN2O3S2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccc(OCc2cnc(Cl)s2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H13ClN2O3S2/c1-15(20(2,16)17)9-3-5-10(6-4-9)18-8-11-7-14-12(13)19-11/h3-7H,8H2,1-2H3 |
| InChIKey | BLGUELMEBGHXJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide (CID 75392450) is N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide is CN(c1ccc(OCc2cnc(Cl)s2)cc1)S(C)(=O)=O.
What is the InChIKey of N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
The InChIKey is BLGUELMEBGHXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O3S2/c1-15(20(2,16)17)9-3-5-10(6-4-9)18-8-11-7-14-12(13)19-11/h3-7H,8H2,1-2H3.
What are the key properties of N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide has a molecular weight of 332.83 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 75392450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).