About 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine
4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine (PubChem CID 75393578) has the molecular formula C13H17N3O2S2
and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine |
| PubChem CID | 75393578 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine |
| SMILES | c1csc(-c2nnc(CSCCN3CCOCC3)o2)c1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-2-11(20-8-1)13-15-14-12(18-13)10-19-9-5-16-3-6-17-7-4-16/h1-2,8H,3-7,9-10H2 |
| InChIKey | ZQWFCTXDXKKQQX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine?
The IUPAC name of 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine (CID 75393578) is 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine.
What is the SMILES notation for 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine?
The canonical SMILES for 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine is c1csc(-c2nnc(CSCCN3CCOCC3)o2)c1.
What is the InChIKey of 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine?
The InChIKey is ZQWFCTXDXKKQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S2/c1-2-11(20-8-1)13-15-14-12(18-13)10-19-9-5-16-3-6-17-7-4-16/h1-2,8H,3-7,9-10H2.
What are the key properties of 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine?
4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine has a molecular weight of 311.43 g/mol, XLogP of 2.36, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methylsulfanyl]ethyl]morpholine is sourced from PubChem (CID 75393578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).