About 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one
2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 75393627) has the molecular formula C15H10Cl2N2OS
and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 75393627 |
| Molecular Formula | C15H10Cl2N2OS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C/C(=C/c1ccc(Cl)cc1Cl)c1nc2sccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H10Cl2N2OS/c1-8(6-9-2-3-10(16)7-12(9)17)13-18-14(20)11-4-5-21-15(11)19-13/h2-7H,1H3,(H,18,19,20)/b8-6- |
| InChIKey | NGCJFBOAHGHNSI-VURMDHGXSA-N |
| XLogP | 4.85 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one (CID 75393627) is 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one is C/C(=C/c1ccc(Cl)cc1Cl)c1nc2sccc2c(=O)[nH]1.
What is the InChIKey of 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is NGCJFBOAHGHNSI-VURMDHGXSA-N. The full InChI is InChI=1S/C15H10Cl2N2OS/c1-8(6-9-2-3-10(16)7-12(9)17)13-18-14(20)11-4-5-21-15(11)19-13/h2-7H,1H3,(H,18,19,20)/b8-6-.
What are the key properties of 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one?
2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 337.23 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-1-(2,4-dichlorophenyl)prop-1-en-2-yl]-3H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 75393627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).