C16H24N2O3 — CID 75393700
propan-2-yl (2R)-2-[(4-propan-2-ylphenyl)carbamoylamino]propanoate (PubChem CID 75393700) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[(4-propan-2-ylphenyl)carbamoylamino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[(4-propan-2-ylphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 75393700 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | propan-2-yl (2R)-2-[(4-propan-2-ylphenyl)carbamoylamino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NC(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-10(2)13-6-8-14(9-7-13)18-16(20)17-12(5)15(19)21-11(3)4/h6-12H,1-5H3,(H2,17,18,20)/t12-/m1/s1 |
| InChIKey | SQCRAWDQRGDCLW-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |