C19H19N5O2 — CID 75394480
N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-N'-(4-methyl-3-pyridinyl)oxamide (PubChem CID 75394480) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-N'-(4-methyl-3-pyridinyl)oxamide.
| Compound Name | N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-N'-(4-methyl-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 75394480 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-N'-(4-methyl-3-pyridinyl)oxamide |
| SMILES | Cc1ccncc1NC(=O)C(=O)NCc1cccc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C19H19N5O2/c1-13-6-7-20-11-17(13)23-19(26)18(25)21-9-14-4-3-5-15(8-14)16-10-22-24(2)12-16/h3-8,10-12H,9H2,1-2H3,(H,21,25)(H,23,26) |
| InChIKey | NRADZKCDRLXOKR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|