C14H13N5O2S — CID 75394492
N-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]thiadiazole-4-carboxamide (PubChem CID 75394492) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is N-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]thiadiazole-4-carboxamide.
| Compound Name | N-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 75394492 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]thiadiazole-4-carboxamide |
| SMILES | COc1cccc(-c2cc(NC(=O)c3csnn3)n(C)n2)c1 |
| InChI | InChI=1S/C14H13N5O2S/c1-19-13(15-14(20)12-8-22-18-16-12)7-11(17-19)9-4-3-5-10(6-9)21-2/h3-8H,1-2H3,(H,15,20) |
| InChIKey | ZBFLRKXRTBTHBY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |