About 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide
2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide (PubChem CID 75395730) has the molecular formula C12H15ClN2O3S
and a molecular weight of 302.78 g/mol. Its IUPAC name is 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide |
| PubChem CID | 75395730 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1c2cc(Cl)ccc2CS1(=O)=O |
| InChI | InChI=1S/C12H15ClN2O3S/c1-8(2)14-12(16)6-15-11-5-10(13)4-3-9(11)7-19(15,17)18/h3-5,8H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | SFLGUGXLRIKISG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide?
The IUPAC name of 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide (CID 75395730) is 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide.
What is the SMILES notation for 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide?
The canonical SMILES for 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide is CC(C)NC(=O)CN1c2cc(Cl)ccc2CS1(=O)=O.
What is the InChIKey of 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide?
The InChIKey is SFLGUGXLRIKISG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O3S/c1-8(2)14-12(16)6-15-11-5-10(13)4-3-9(11)7-19(15,17)18/h3-5,8H,6-7H2,1-2H3,(H,14,16).
What are the key properties of 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide?
2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide has a molecular weight of 302.78 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-2,2-dioxo-3H-2,1-benzothiazol-1-yl)-N-propan-2-ylacetamide is sourced from PubChem (CID 75395730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).