About 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide
2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide (PubChem CID 75396064) has the molecular formula C16H17N5O4S
and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide |
| PubChem CID | 75396064 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide |
| SMILES | Cc1cnc(N)c(S(=O)(=O)Nc2cccc(CN3C(=O)CNC3=O)c2)c1 |
| InChI | InChI=1S/C16H17N5O4S/c1-10-5-13(15(17)18-7-10)26(24,25)20-12-4-2-3-11(6-12)9-21-14(22)8-19-16(21)23/h2-7,20H,8-9H2,1H3,(H2,17,18)(H,19,23) |
| InChIKey | QXHIYDWGPCRXPC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide?
The IUPAC name of 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide (CID 75396064) is 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide.
What is the SMILES notation for 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide?
The canonical SMILES for 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide is Cc1cnc(N)c(S(=O)(=O)Nc2cccc(CN3C(=O)CNC3=O)c2)c1.
What is the InChIKey of 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide?
The InChIKey is QXHIYDWGPCRXPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O4S/c1-10-5-13(15(17)18-7-10)26(24,25)20-12-4-2-3-11(6-12)9-21-14(22)8-19-16(21)23/h2-7,20H,8-9H2,1H3,(H2,17,18)(H,19,23).
What are the key properties of 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide?
2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide has a molecular weight of 375.41 g/mol, XLogP of 0.82, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-5-methylpyridine-3-sulfonamide is sourced from PubChem (CID 75396064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).