C18H25F2NO4S — CID 75397104
3-[(2,4-difluorophenyl)methyl]-8-(2-ethoxyethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 75397104) has the molecular formula C18H25F2NO4S and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-8-(2-ethoxyethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-8-(2-ethoxyethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 75397104 |
| Molecular Formula | C18H25F2NO4S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-8-(2-ethoxyethylsulfonyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CCOCCS(=O)(=O)N1C2CCC1CC(O)(Cc1ccc(F)cc1F)C2 |
| InChI | InChI=1S/C18H25F2NO4S/c1-2-25-7-8-26(23,24)21-15-5-6-16(21)12-18(22,11-15)10-13-3-4-14(19)9-17(13)20/h3-4,9,15-16,22H,2,5-8,10-12H2,1H3 |
| InChIKey | QCWCXTJDBPEHNU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|