C18H25NO5 — CID 75397200
(2-hydroxy-3-propan-2-yloxypropyl) 1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 75397200) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2-hydroxy-3-propan-2-yloxypropyl) 1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-hydroxy-3-propan-2-yloxypropyl) 1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 75397200 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (2-hydroxy-3-propan-2-yloxypropyl) 1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(N2CC(C(=O)OCC(O)COC(C)C)CC2=O)cc1 |
| InChI | InChI=1S/C18H25NO5/c1-12(2)23-10-16(20)11-24-18(22)14-8-17(21)19(9-14)15-6-4-13(3)5-7-15/h4-7,12,14,16,20H,8-11H2,1-3H3 |
| InChIKey | KTWLHQMEFAFLCM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |