About ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate
ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate (PubChem CID 75397368) has the molecular formula C16H20N4O5
and a molecular weight of 348.36 g/mol. Its IUPAC name is ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate |
| PubChem CID | 75397368 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)c1ccc(NC(=O)NC2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C16H20N4O5/c1-3-25-16(24)20(2)11-6-4-10(5-7-11)17-15(23)18-12-8-9-13(21)19-14(12)22/h4-7,12H,3,8-9H2,1-2H3,(H2,17,18,23)(H,19,21,22) |
| InChIKey | UAMKJYXYKBHTHY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate?
The IUPAC name of ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate (CID 75397368) is ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate.
What is the SMILES notation for ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate?
The canonical SMILES for ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate is CCOC(=O)N(C)c1ccc(NC(=O)NC2CCC(=O)NC2=O)cc1.
What is the InChIKey of ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate?
The InChIKey is UAMKJYXYKBHTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O5/c1-3-25-16(24)20(2)11-6-4-10(5-7-11)17-15(23)18-12-8-9-13(21)19-14(12)22/h4-7,12H,3,8-9H2,1-2H3,(H2,17,18,23)(H,19,21,22).
What are the key properties of ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate?
ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate has a molecular weight of 348.36 g/mol, XLogP of 1.21, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]phenyl]-N-methylcarbamate is sourced from PubChem (CID 75397368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).