About methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate
methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate (PubChem CID 75397652) has the molecular formula C11H15N3O3S
and a molecular weight of 269.33 g/mol. Its IUPAC name is methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate |
| PubChem CID | 75397652 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)Nc2nc(C)c(C)s2)CC1 |
| InChI | InChI=1S/C11H15N3O3S/c1-6-7(2)18-10(12-6)13-9(16)14-11(4-5-11)8(15)17-3/h4-5H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | PPBIHGBGIVVNHU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate (CID 75397652) is methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate is COC(=O)C1(NC(=O)Nc2nc(C)c(C)s2)CC1.
What is the InChIKey of methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate?
The InChIKey is PPBIHGBGIVVNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S/c1-6-7(2)18-10(12-6)13-9(16)14-11(4-5-11)8(15)17-3/h4-5H2,1-3H3,(H2,12,13,14,16).
What are the key properties of methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate?
methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate has a molecular weight of 269.33 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]cyclopropane-1-carboxylate is sourced from PubChem (CID 75397652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).