C17H25N5O3 — CID 75398084
1-[3-(2-ethoxyethoxymethyl)phenyl]-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 75398084) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[3-(2-ethoxyethoxymethyl)phenyl]-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 1-[3-(2-ethoxyethoxymethyl)phenyl]-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 75398084 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[3-(2-ethoxyethoxymethyl)phenyl]-3-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | CCOCCOCc1cccc(NC(=O)NCCc2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C17H25N5O3/c1-3-24-9-10-25-12-14-5-4-6-15(11-14)20-17(23)18-8-7-16-19-13(2)21-22-16/h4-6,11H,3,7-10,12H2,1-2H3,(H2,18,20,23)(H,19,21,22) |
| InChIKey | UDWKPSJHZIOTOI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|