About 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide
2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide (PubChem CID 75398566) has the molecular formula C18H30F3N3O
and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide |
| PubChem CID | 75398566 |
| Molecular Formula | C18H30F3N3O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide |
| SMILES | O=C(CC1CCCC1)NC1CCN(C2CCN(CC(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C18H30F3N3O/c19-18(20,21)13-23-8-7-16(12-23)24-9-5-15(6-10-24)22-17(25)11-14-3-1-2-4-14/h14-16H,1-13H2,(H,22,25) |
| InChIKey | GSTBWYNZIZLPDI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide?
The IUPAC name of 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide (CID 75398566) is 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide.
What is the SMILES notation for 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide?
The canonical SMILES for 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide is O=C(CC1CCCC1)NC1CCN(C2CCN(CC(F)(F)F)C2)CC1.
What is the InChIKey of 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide?
The InChIKey is GSTBWYNZIZLPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30F3N3O/c19-18(20,21)13-23-8-7-16(12-23)24-9-5-15(6-10-24)22-17(25)11-14-3-1-2-4-14/h14-16H,1-13H2,(H,22,25).
What are the key properties of 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide?
2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide has a molecular weight of 361.45 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-[1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidin-4-yl]acetamide is sourced from PubChem (CID 75398566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).