About 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane
5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane (PubChem CID 75399335) has the molecular formula C11H26N2O3S
and a molecular weight of 266.41 g/mol. Its IUPAC name is 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane.
Molecular Properties
| Compound Name | 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane |
| PubChem CID | 75399335 |
| Molecular Formula | C11H26N2O3S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane |
| SMILES | CC(C)N(C)S(=O)(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C11H26N2O3S/c1-10(2)13(5)17(15,16)12-9-11(3,4)7-6-8-14/h10,12,14H,6-9H2,1-5H3 |
| InChIKey | IMAGVLMJBICGIK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
The IUPAC name of 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane (CID 75399335) is 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane.
What is the SMILES notation for 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
The canonical SMILES for 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane is CC(C)N(C)S(=O)(=O)NCC(C)(C)CCCO.
What is the InChIKey of 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
The InChIKey is IMAGVLMJBICGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O3S/c1-10(2)13(5)17(15,16)12-9-11(3,4)7-6-8-14/h10,12,14H,6-9H2,1-5H3.
What are the key properties of 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane?
5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane has a molecular weight of 266.41 g/mol, XLogP of 0.96, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,2-dimethyl-1-[[methyl(propan-2-yl)sulfamoyl]amino]pentane is sourced from PubChem (CID 75399335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).