C17H25NO4S — CID 75399586
2-(4-acetyl-2-methoxyphenoxy)-N-methyl-N-(1-methylsulfanylbutan-2-yl)acetamide (PubChem CID 75399586) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-methyl-N-(1-methylsulfanylbutan-2-yl)acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-methyl-N-(1-methylsulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 75399586 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-methyl-N-(1-methylsulfanylbutan-2-yl)acetamide |
| SMILES | CCC(CSC)N(C)C(=O)COc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C17H25NO4S/c1-6-14(11-23-5)18(3)17(20)10-22-15-8-7-13(12(2)19)9-16(15)21-4/h7-9,14H,6,10-11H2,1-5H3 |
| InChIKey | JXZRESXWPOMJSK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |