C17H15BrN4O3S — CID 75400915
N-[2-[(3-bromobenzoyl)amino]ethyl]-3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 75400915) has the molecular formula C17H15BrN4O3S and a molecular weight of 435.30 g/mol. Its IUPAC name is N-[2-[(3-bromobenzoyl)amino]ethyl]-3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | N-[2-[(3-bromobenzoyl)amino]ethyl]-3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 75400915 |
| Molecular Formula | C17H15BrN4O3S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | N-[2-[(3-bromobenzoyl)amino]ethyl]-3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | Cc1csc2ncc(C(=O)NCCNC(=O)c3cccc(Br)c3)c(=O)n12 |
| InChI | InChI=1S/C17H15BrN4O3S/c1-10-9-26-17-21-8-13(16(25)22(10)17)15(24)20-6-5-19-14(23)11-3-2-4-12(18)7-11/h2-4,7-9H,5-6H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | PIIOZIPTDNAVAH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|