C20H27N5O2 — CID 75401507
2-methyl-3-[[4-(3-methyl-4-nitrophenyl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 75401507) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-methyl-3-[[4-(3-methyl-4-nitrophenyl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 2-methyl-3-[[4-(3-methyl-4-nitrophenyl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 75401507 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-methyl-3-[[4-(3-methyl-4-nitrophenyl)piperazin-1-yl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | Cc1cc(N2CCN(Cc3c(C)nc4n3CCCC4)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27N5O2/c1-15-13-17(6-7-18(15)25(26)27)23-11-9-22(10-12-23)14-19-16(2)21-20-5-3-4-8-24(19)20/h6-7,13H,3-5,8-12,14H2,1-2H3 |
| InChIKey | DQFCKXHVYGACHR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|