C20H13ClN2O3S — CID 75401863
(5-chlorothiophen-2-yl)methyl 4-(4-oxoquinazolin-3-yl)benzoate (PubChem CID 75401863) has the molecular formula C20H13ClN2O3S and a molecular weight of 396.86 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl 4-(4-oxoquinazolin-3-yl)benzoate.
| Compound Name | (5-chlorothiophen-2-yl)methyl 4-(4-oxoquinazolin-3-yl)benzoate |
|---|---|
| PubChem CID | 75401863 |
| Molecular Formula | C20H13ClN2O3S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl 4-(4-oxoquinazolin-3-yl)benzoate |
| SMILES | O=C(OCc1ccc(Cl)s1)c1ccc(-n2cnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C20H13ClN2O3S/c21-18-10-9-15(27-18)11-26-20(25)13-5-7-14(8-6-13)23-12-22-17-4-2-1-3-16(17)19(23)24/h1-10,12H,11H2 |
| InChIKey | IZHPWNHITOLWPZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |