C15H16N2O4S2 — CID 75402059
(2-anilino-1,3-thiazol-4-yl)methyl 1,1-dioxothiolane-3-carboxylate (PubChem CID 75402059) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-4-yl)methyl 1,1-dioxothiolane-3-carboxylate.
| Compound Name | (2-anilino-1,3-thiazol-4-yl)methyl 1,1-dioxothiolane-3-carboxylate |
|---|---|
| PubChem CID | 75402059 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (2-anilino-1,3-thiazol-4-yl)methyl 1,1-dioxothiolane-3-carboxylate |
| SMILES | O=C(OCc1csc(Nc2ccccc2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-14(11-6-7-23(19,20)10-11)21-8-13-9-22-15(17-13)16-12-4-2-1-3-5-12/h1-5,9,11H,6-8,10H2,(H,16,17) |
| InChIKey | NSTHLXVIFXDMEY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |