C15H22N4 — CID 75402177
N,N-dimethyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]aniline (PubChem CID 75402177) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is N,N-dimethyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]aniline.
| Compound Name | N,N-dimethyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]aniline |
|---|---|
| PubChem CID | 75402177 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N,N-dimethyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]aniline |
| SMILES | CN(Cc1ccc(N(C)C)cc1)Cc1cnn(C)c1 |
| InChI | InChI=1S/C15H22N4/c1-17(2)15-7-5-13(6-8-15)10-18(3)11-14-9-16-19(4)12-14/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | UGBKCVXNLONSFL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|