C20H16N4O2S — CID 75402462
(1-cyanoindolizin-2-yl)methyl (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate (PubChem CID 75402462) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75402462 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl (E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoate |
| SMILES | Cc1cn2c(/C=C/C(=O)OCc3cn4ccccc4c3C#N)c(C)nc2s1 |
| InChI | InChI=1S/C20H16N4O2S/c1-13-10-24-17(14(2)22-20(24)27-13)6-7-19(25)26-12-15-11-23-8-4-3-5-18(23)16(15)9-21/h3-8,10-11H,12H2,1-2H3/b7-6+ |
| InChIKey | NPPDNHSEDWRPKX-VOTSOKGWSA-N |
| XLogP | 3.89 |
| TPSA | 71.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|