C20H18N2O5 — CID 75402631
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate (PubChem CID 75402631) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
|---|---|
| PubChem CID | 75402631 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetate |
| SMILES | O=C1CCc2cc(OC(=O)CN3C(=O)C4C5C=CC(C5)C4C3=O)ccc2N1 |
| InChI | InChI=1S/C20H18N2O5/c23-15-6-3-10-8-13(4-5-14(10)21-15)27-16(24)9-22-19(25)17-11-1-2-12(7-11)18(17)20(22)26/h1-2,4-5,8,11-12,17-18H,3,6-7,9H2,(H,21,23) |
| InChIKey | GULFADYWBYKABC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|